C14H12F3NO4 — CID 167361002
ethyl 5,6,7-trifluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylate (PubChem CID 167361002) has the molecular formula C14H12F3NO4 and a molecular weight of 315.25 g/mol. Its IUPAC name is ethyl 5,6,7-trifluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 5,6,7-trifluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 167361002 |
| Molecular Formula | C14H12F3NO4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | ethyl 5,6,7-trifluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CCO)c2cc(F)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C14H12F3NO4/c1-2-22-14(21)7-6-18(3-4-19)9-5-8(15)11(16)12(17)10(9)13(7)20/h5-6,19H,2-4H2,1H3 |
| InChIKey | KWENSLGVRVNQEY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|