C22H20ClFINO4 — CID 89378983
ethyl 6-[[2-chloro-3-(iodomethyl)phenyl]methyl]-8-fluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylate (PubChem CID 89378983) has the molecular formula C22H20ClFINO4 and a molecular weight of 543.76 g/mol. Its IUPAC name is ethyl 6-[[2-chloro-3-(iodomethyl)phenyl]methyl]-8-fluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 6-[[2-chloro-3-(iodomethyl)phenyl]methyl]-8-fluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 89378983 |
| Molecular Formula | C22H20ClFINO4 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | ethyl 6-[[2-chloro-3-(iodomethyl)phenyl]methyl]-8-fluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CCO)c2c(F)cc(Cc3cccc(CI)c3Cl)cc2c1=O |
| InChI | InChI=1S/C22H20ClFINO4/c1-2-30-22(29)17-12-26(6-7-27)20-16(21(17)28)9-13(10-18(20)24)8-14-4-3-5-15(11-25)19(14)23/h3-5,9-10,12,27H,2,6-8,11H2,1H3 |
| InChIKey | KCTZGTDNSMFBLB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|