C13H11FINO3 — CID 21192608
ethyl 8-fluoro-6-iodo-1-methyl-4-oxoquinoline-3-carboxylate (PubChem CID 21192608) has the molecular formula C13H11FINO3 and a molecular weight of 375.14 g/mol. Its IUPAC name is ethyl 8-fluoro-6-iodo-1-methyl-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 8-fluoro-6-iodo-1-methyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 21192608 |
| Molecular Formula | C13H11FINO3 |
| Molecular Weight | 375.14 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | ethyl 8-fluoro-6-iodo-1-methyl-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C)c2c(F)cc(I)cc2c1=O |
| InChI | InChI=1S/C13H11FINO3/c1-3-19-13(18)9-6-16(2)11-8(12(9)17)4-7(15)5-10(11)14/h4-6H,3H2,1-2H3 |
| InChIKey | KGFNWAMJMGLNBN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.14 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|