C14H11F3N2O4 — CID 141213468
ethyl 1-acetamido-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate (PubChem CID 141213468) has the molecular formula C14H11F3N2O4 and a molecular weight of 328.25 g/mol. Its IUPAC name is ethyl 1-acetamido-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-acetamido-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 141213468 |
| Molecular Formula | C14H11F3N2O4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | ethyl 1-acetamido-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(NC(C)=O)c2c(F)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C14H11F3N2O4/c1-3-23-14(22)8-5-19(18-6(2)20)12-7(13(8)21)4-9(15)10(16)11(12)17/h4-5H,3H2,1-2H3,(H,18,20) |
| InChIKey | OWAAYXMDDQDGKW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|