C15H11ClF3NO3 — CID 15094162
ethyl 1-(3-chloroprop-1-en-2-yl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate (PubChem CID 15094162) has the molecular formula C15H11ClF3NO3 and a molecular weight of 345.70 g/mol. Its IUPAC name is ethyl 1-(3-chloroprop-1-en-2-yl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-(3-chloroprop-1-en-2-yl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 15094162 |
| Molecular Formula | C15H11ClF3NO3 |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | ethyl 1-(3-chloroprop-1-en-2-yl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate |
| SMILES | C=C(CCl)n1cc(C(=O)OCC)c(=O)c2cc(F)c(F)c(F)c21 |
| InChI | InChI=1S/C15H11ClF3NO3/c1-3-23-15(22)9-6-20(7(2)5-16)13-8(14(9)21)4-10(17)11(18)12(13)19/h4,6H,2-3,5H2,1H3 |
| InChIKey | DXLAVYFENNYFFW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|