C27H32ClFN2O6Si — CID 71215303
ethyl 6-[(3-chloro-2-fluorophenyl)methyl]-1-[4-[hydroxy(dimethyl)silyl]-4-methylpentyl]-8-nitro-4-oxoquinoline-3-carboxylate (PubChem CID 71215303) has the molecular formula C27H32ClFN2O6Si and a molecular weight of 563.10 g/mol. Its IUPAC name is ethyl 6-[(3-chloro-2-fluorophenyl)methyl]-1-[4-[hydroxy(dimethyl)silyl]-4-methylpentyl]-8-nitro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 6-[(3-chloro-2-fluorophenyl)methyl]-1-[4-[hydroxy(dimethyl)silyl]-4-methylpentyl]-8-nitro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 71215303 |
| Molecular Formula | C27H32ClFN2O6Si |
| Molecular Weight | 563.10 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | ethyl 6-[(3-chloro-2-fluorophenyl)methyl]-1-[4-[hydroxy(dimethyl)silyl]-4-methylpentyl]-8-nitro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CCCC(C)(C)[Si](C)(C)O)c2c([N+](=O)[O-])cc(Cc3cccc(Cl)c3F)cc2c1=O |
| InChI | InChI=1S/C27H32ClFN2O6Si/c1-6-37-26(33)20-16-30(12-8-11-27(2,3)38(4,5)36)24-19(25(20)32)14-17(15-22(24)31(34)35)13-18-9-7-10-21(28)23(18)29/h7,9-10,14-16,36H,6,8,11-13H2,1-5H3 |
| InChIKey | XNTMUANSCFEIHM-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.10 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|