C22H22FN5O5 — CID 11442427
ethyl 8-fluoro-1-methyl-6-nitro-4-oxo-7-(4-pyridin-2-ylpiperazin-1-yl)quinoline-3-carboxylate (PubChem CID 11442427) has the molecular formula C22H22FN5O5 and a molecular weight of 455.45 g/mol. Its IUPAC name is ethyl 8-fluoro-1-methyl-6-nitro-4-oxo-7-(4-pyridin-2-ylpiperazin-1-yl)quinoline-3-carboxylate.
| Compound Name | ethyl 8-fluoro-1-methyl-6-nitro-4-oxo-7-(4-pyridin-2-ylpiperazin-1-yl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 11442427 |
| Molecular Formula | C22H22FN5O5 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | ethyl 8-fluoro-1-methyl-6-nitro-4-oxo-7-(4-pyridin-2-ylpiperazin-1-yl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C)c2c(F)c(N3CCN(c4ccccn4)CC3)c([N+](=O)[O-])cc2c1=O |
| InChI | InChI=1S/C22H22FN5O5/c1-3-33-22(30)15-13-25(2)19-14(21(15)29)12-16(28(31)32)20(18(19)23)27-10-8-26(9-11-27)17-6-4-5-7-24-17/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | KVCOIFMOLYYPCF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|