C24H25FN4O5 — CID 10814129
ethyl 1-(4-fluorophenyl)-8-methyl-7-(4-methylpiperazin-1-yl)-6-nitro-4-oxoquinoline-3-carboxylate (PubChem CID 10814129) has the molecular formula C24H25FN4O5 and a molecular weight of 468.49 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-8-methyl-7-(4-methylpiperazin-1-yl)-6-nitro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)-8-methyl-7-(4-methylpiperazin-1-yl)-6-nitro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10814129 |
| Molecular Formula | C24H25FN4O5 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-8-methyl-7-(4-methylpiperazin-1-yl)-6-nitro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(F)cc2)c2c(C)c(N3CCN(C)CC3)c([N+](=O)[O-])cc2c1=O |
| InChI | InChI=1S/C24H25FN4O5/c1-4-34-24(31)19-14-28(17-7-5-16(25)6-8-17)21-15(2)22(27-11-9-26(3)10-12-27)20(29(32)33)13-18(21)23(19)30/h5-8,13-14H,4,9-12H2,1-3H3 |
| InChIKey | ADOWKPOLANVCTA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|