C28H22ClF2N3O6 — CID 25242975
7-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(2,4-difluorophenyl)-8-methyl-6-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 25242975) has the molecular formula C28H22ClF2N3O6 and a molecular weight of 569.95 g/mol. Its IUPAC name is 7-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(2,4-difluorophenyl)-8-methyl-6-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(2,4-difluorophenyl)-8-methyl-6-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 25242975 |
| Molecular Formula | C28H22ClF2N3O6 |
| Molecular Weight | 569.95 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 7-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(2,4-difluorophenyl)-8-methyl-6-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | Cc1c(N2CCC(O)(c3ccc(Cl)cc3)CC2)c([N+](=O)[O-])cc2c(=O)c(C(=O)O)cn(-c3ccc(F)cc3F)c12 |
| InChI | InChI=1S/C28H22ClF2N3O6/c1-15-24-19(26(35)20(27(36)37)14-33(24)22-7-6-18(30)12-21(22)31)13-23(34(39)40)25(15)32-10-8-28(38,9-11-32)16-2-4-17(29)5-3-16/h2-7,12-14,38H,8-11H2,1H3,(H,36,37) |
| InChIKey | PBGYNKFYQJHUML-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.95 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|