C25H21F4N3O3 — CID 19374421
1-(2,4-difluorophenyl)-6,8-difluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 19374421) has the molecular formula C25H21F4N3O3 and a molecular weight of 487.45 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-6,8-difluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(2,4-difluorophenyl)-6,8-difluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19374421 |
| Molecular Formula | C25H21F4N3O3 |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-6,8-difluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CNC1C=CCC2CN(c3c(F)cc4c(=O)c(C(=O)O)cn(-c5ccc(F)cc5F)c4c3F)CC21 |
| InChI | InChI=1S/C25H21F4N3O3/c1-30-19-4-2-3-12-9-31(10-15(12)19)23-18(28)8-14-22(21(23)29)32(11-16(24(14)33)25(34)35)20-6-5-13(26)7-17(20)27/h2,4-8,11-12,15,19,30H,3,9-10H2,1H3,(H,34,35) |
| InChIKey | WIKBAWDNNCYKAO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|