C23H21ClF2N4O3 — CID 67784720
7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-(2,4-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxylic acid;hydrochloride (PubChem CID 67784720) has the molecular formula C23H21ClF2N4O3 and a molecular weight of 474.90 g/mol. Its IUPAC name is 7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-(2,4-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxylic acid;hydrochloride.
| Compound Name | 7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-(2,4-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67784720 |
| Molecular Formula | C23H21ClF2N4O3 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-(2,4-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.NC1C=CCC2CN(c3ccc4c(=O)c(C(=O)O)cn(-c5ccc(F)cc5F)c4n3)CC12 |
| InChI | InChI=1S/C23H20F2N4O3.ClH/c24-13-4-6-19(17(25)8-13)29-11-16(23(31)32)21(30)14-5-7-20(27-22(14)29)28-9-12-2-1-3-18(26)15(12)10-28;/h1,3-8,11-12,15,18H,2,9-10,26H2,(H,31,32);1H |
| InChIKey | IBKFCQVNFZZRAJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|