C27H26F2N4O2 — CID 135355002
N-(1-adamantyl)-7-(aziridin-1-yl)-1-(2,4-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 135355002) has the molecular formula C27H26F2N4O2 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-(1-adamantyl)-7-(aziridin-1-yl)-1-(2,4-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(1-adamantyl)-7-(aziridin-1-yl)-1-(2,4-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135355002 |
| Molecular Formula | C27H26F2N4O2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-(1-adamantyl)-7-(aziridin-1-yl)-1-(2,4-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1cn(-c2ccc(F)cc2F)c2nc(N3CC3)ccc2c1=O |
| InChI | InChI=1S/C27H26F2N4O2/c28-18-1-3-22(21(29)10-18)33-14-20(24(34)19-2-4-23(30-25(19)33)32-5-6-32)26(35)31-27-11-15-7-16(12-27)9-17(8-15)13-27/h1-4,10,14-17H,5-9,11-13H2,(H,31,35) |
| InChIKey | GKTFNQHZNNQKNU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|