C31H31F4N3O4 — CID 157358143
3-[2-(1-adamantyl)acetyl]-7-(3,3-difluoro-4,4-dihydroxypiperidin-1-yl)-1-(2,4-difluorophenyl)-1,8-naphthyridin-4-one (PubChem CID 157358143) has the molecular formula C31H31F4N3O4 and a molecular weight of 585.60 g/mol. Its IUPAC name is 3-[2-(1-adamantyl)acetyl]-7-(3,3-difluoro-4,4-dihydroxypiperidin-1-yl)-1-(2,4-difluorophenyl)-1,8-naphthyridin-4-one.
| Compound Name | 3-[2-(1-adamantyl)acetyl]-7-(3,3-difluoro-4,4-dihydroxypiperidin-1-yl)-1-(2,4-difluorophenyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 157358143 |
| Molecular Formula | C31H31F4N3O4 |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 3-[2-(1-adamantyl)acetyl]-7-(3,3-difluoro-4,4-dihydroxypiperidin-1-yl)-1-(2,4-difluorophenyl)-1,8-naphthyridin-4-one |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)c1cn(-c2ccc(F)cc2F)c2nc(N3CCC(O)(O)C(F)(F)C3)ccc2c1=O |
| InChI | InChI=1S/C31H31F4N3O4/c32-20-1-3-24(23(33)10-20)38-15-22(25(39)14-29-11-17-7-18(12-29)9-19(8-17)13-29)27(40)21-2-4-26(36-28(21)38)37-6-5-31(41,42)30(34,35)16-37/h1-4,10,15,17-19,41-42H,5-9,11-14,16H2 |
| InChIKey | BIIDHWAEJGYVFY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|