C25H23F5N4O3 — CID 135354882
1-(2,4-difluorophenyl)-7-(1-hydroxy-3-azabicyclo[4.1.0]heptan-3-yl)-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 135354882) has the molecular formula C25H23F5N4O3 and a molecular weight of 522.47 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-7-(1-hydroxy-3-azabicyclo[4.1.0]heptan-3-yl)-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-7-(1-hydroxy-3-azabicyclo[4.1.0]heptan-3-yl)-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135354882 |
| Molecular Formula | C25H23F5N4O3 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-7-(1-hydroxy-3-azabicyclo[4.1.0]heptan-3-yl)-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1cn(-c2ccc(F)cc2F)c2nc(N3CCC4CC4(O)C3)ccc2c1=O)C(F)(F)F |
| InChI | InChI=1S/C25H23F5N4O3/c1-2-19(25(28,29)30)31-23(36)16-11-34(18-5-3-14(26)9-17(18)27)22-15(21(16)35)4-6-20(32-22)33-8-7-13-10-24(13,37)12-33/h3-6,9,11,13,19,37H,2,7-8,10,12H2,1H3,(H,31,36) |
| InChIKey | JDHZUQJDKWWEQF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |