C22H17F8N5O4 — CID 163992922
1-(3,5-difluoro-2-pyridinyl)-7-[(3R)-3,4-dihydroxypyrrolidin-1-yl]-N-(1,1,1,4,4,4-hexafluorobutan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 163992922) has the molecular formula C22H17F8N5O4 and a molecular weight of 567.39 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-pyridinyl)-7-[(3R)-3,4-dihydroxypyrrolidin-1-yl]-N-(1,1,1,4,4,4-hexafluorobutan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(3,5-difluoro-2-pyridinyl)-7-[(3R)-3,4-dihydroxypyrrolidin-1-yl]-N-(1,1,1,4,4,4-hexafluorobutan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 163992922 |
| Molecular Formula | C22H17F8N5O4 |
| Molecular Weight | 567.39 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 1-(3,5-difluoro-2-pyridinyl)-7-[(3R)-3,4-dihydroxypyrrolidin-1-yl]-N-(1,1,1,4,4,4-hexafluorobutan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NC(CC(F)(F)F)C(F)(F)F)c1cn(-c2ncc(F)cc2F)c2nc(N3CC(O)[C@H](O)C3)ccc2c1=O |
| InChI | InChI=1S/C22H17F8N5O4/c23-9-3-12(24)19(31-5-9)35-6-11(20(39)32-15(22(28,29)30)4-21(25,26)27)17(38)10-1-2-16(33-18(10)35)34-7-13(36)14(37)8-34/h1-3,5-6,13-15,36-37H,4,7-8H2,(H,32,39)/t13-,14?,15?/m1/s1 |
| InChIKey | UCFSTCPWZDWCJI-WLYUNCDWSA-N |
| XLogP | 2.21 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |