C22H14F8N4O4 — CID 148690995
1-(3,5-difluoro-2-pyridinyl)-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-[(4R)-4-hydroxy-2-oxocyclopentyl]-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 148690995) has the molecular formula C22H14F8N4O4 and a molecular weight of 550.36 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-pyridinyl)-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-[(4R)-4-hydroxy-2-oxocyclopentyl]-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(3,5-difluoro-2-pyridinyl)-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-[(4R)-4-hydroxy-2-oxocyclopentyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 148690995 |
| Molecular Formula | C22H14F8N4O4 |
| Molecular Weight | 550.36 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 1-(3,5-difluoro-2-pyridinyl)-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-7-[(4R)-4-hydroxy-2-oxocyclopentyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NC(C(F)(F)F)C(F)(F)F)c1cn(-c2ncc(F)cc2F)c2nc(C3C[C@@H](O)CC3=O)ccc2c1=O |
| InChI | InChI=1S/C22H14F8N4O4/c23-8-3-13(24)18(31-6-8)34-7-12(19(38)33-20(21(25,26)27)22(28,29)30)16(37)10-1-2-14(32-17(10)34)11-4-9(35)5-15(11)36/h1-3,6-7,9,11,20,35H,4-5H2,(H,33,38)/t9-,11?/m1/s1 |
| InChIKey | NTLXZLNKVMCNPN-BFHBGLAWSA-N |
| XLogP | 3.09 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |