C23H20F7N5O2 — CID 134181892
7-(3,3-difluoropiperidin-1-yl)-1-(3,5-difluoro-2-pyridinyl)-4-oxo-N-[(2R)-1,1,1-trifluorobutan-2-yl]-1,8-naphthyridine-3-carboxamide (PubChem CID 134181892) has the molecular formula C23H20F7N5O2 and a molecular weight of 531.43 g/mol. Its IUPAC name is 7-(3,3-difluoropiperidin-1-yl)-1-(3,5-difluoro-2-pyridinyl)-4-oxo-N-[(2R)-1,1,1-trifluorobutan-2-yl]-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-(3,3-difluoropiperidin-1-yl)-1-(3,5-difluoro-2-pyridinyl)-4-oxo-N-[(2R)-1,1,1-trifluorobutan-2-yl]-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134181892 |
| Molecular Formula | C23H20F7N5O2 |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 7-(3,3-difluoropiperidin-1-yl)-1-(3,5-difluoro-2-pyridinyl)-4-oxo-N-[(2R)-1,1,1-trifluorobutan-2-yl]-1,8-naphthyridine-3-carboxamide |
| SMILES | CC[C@@H](NC(=O)c1cn(-c2ncc(F)cc2F)c2nc(N3CCCC(F)(F)C3)ccc2c1=O)C(F)(F)F |
| InChI | InChI=1S/C23H20F7N5O2/c1-2-16(23(28,29)30)32-21(37)14-10-35(20-15(25)8-12(24)9-31-20)19-13(18(14)36)4-5-17(33-19)34-7-3-6-22(26,27)11-34/h4-5,8-10,16H,2-3,6-7,11H2,1H3,(H,32,37)/t16-/m1/s1 |
| InChIKey | BVRSZNGCDDMUKQ-MRXNPFEDSA-N |
| XLogP | 4.37 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |