C23H18F7N5O4 — CID 134181761
1-(3,5-difluoro-2-pyridinyl)-7-[(4S)-4-hydroxy-2-oxopyrrolidin-1-yl]-4-oxo-N-(1,1,1,2,2-pentafluoropentan-3-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 134181761) has the molecular formula C23H18F7N5O4 and a molecular weight of 561.41 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-pyridinyl)-7-[(4S)-4-hydroxy-2-oxopyrrolidin-1-yl]-4-oxo-N-(1,1,1,2,2-pentafluoropentan-3-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(3,5-difluoro-2-pyridinyl)-7-[(4S)-4-hydroxy-2-oxopyrrolidin-1-yl]-4-oxo-N-(1,1,1,2,2-pentafluoropentan-3-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134181761 |
| Molecular Formula | C23H18F7N5O4 |
| Molecular Weight | 561.41 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 1-(3,5-difluoro-2-pyridinyl)-7-[(4S)-4-hydroxy-2-oxopyrrolidin-1-yl]-4-oxo-N-(1,1,1,2,2-pentafluoropentan-3-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1cn(-c2ncc(F)cc2F)c2nc(N3C[C@@H](O)CC3=O)ccc2c1=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H18F7N5O4/c1-2-15(22(26,27)23(28,29)30)32-21(39)13-9-35(20-14(25)5-10(24)7-31-20)19-12(18(13)38)3-4-16(33-19)34-8-11(36)6-17(34)37/h3-5,7,9,11,15,36H,2,6,8H2,1H3,(H,32,39)/t11-,15?/m0/s1 |
| InChIKey | GFELXPLCKHGNAR-VPHXOMNUSA-N |
| XLogP | 2.86 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|