C24H19F9N4O4 — CID 139431794
7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-(1,1,1,2,2-pentafluoropentan-3-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 139431794) has the molecular formula C24H19F9N4O4 and a molecular weight of 598.42 g/mol. Its IUPAC name is 7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-(1,1,1,2,2-pentafluoropentan-3-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-(1,1,1,2,2-pentafluoropentan-3-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 139431794 |
| Molecular Formula | C24H19F9N4O4 |
| Molecular Weight | 598.42 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-(1,1,1,2,2-pentafluoropentan-3-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1cn(-c2c(F)cc(F)cc2F)c2nc(N3C[C@@H](O)[C@H](O)C3)c(F)cc2c1=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H19F9N4O4/c1-2-17(23(29,30)24(31,32)33)34-22(41)11-6-37(18-12(26)3-9(25)4-13(18)27)20-10(19(11)40)5-14(28)21(35-20)36-7-15(38)16(39)8-36/h3-6,15-17,38-39H,2,7-8H2,1H3,(H,34,41)/t15-,16-,17?/m1/s1 |
| InChIKey | QQMJTBSIYVPEBD-YNPPLXCJSA-N |
| XLogP | 3.19 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|