C22H16ClF7N4O3 — CID 134360016
N-[(1R)-1-chloro-2,2,2-trifluoroethyl]-6-fluoro-7-[(3S,4R)-3-hydroxy-4-methylpyrrolidin-1-yl]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 134360016) has the molecular formula C22H16ClF7N4O3 and a molecular weight of 552.83 g/mol. Its IUPAC name is N-[(1R)-1-chloro-2,2,2-trifluoroethyl]-6-fluoro-7-[(3S,4R)-3-hydroxy-4-methylpyrrolidin-1-yl]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-[(1R)-1-chloro-2,2,2-trifluoroethyl]-6-fluoro-7-[(3S,4R)-3-hydroxy-4-methylpyrrolidin-1-yl]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134360016 |
| Molecular Formula | C22H16ClF7N4O3 |
| Molecular Weight | 552.83 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | N-[(1R)-1-chloro-2,2,2-trifluoroethyl]-6-fluoro-7-[(3S,4R)-3-hydroxy-4-methylpyrrolidin-1-yl]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2nc3c(cc2F)c(=O)c(C(=O)N[C@H](Cl)C(F)(F)F)cn3-c2c(F)cc(F)cc2F)C[C@H]1O |
| InChI | InChI=1S/C22H16ClF7N4O3/c1-8-5-33(7-15(8)35)19-14(27)4-10-17(36)11(20(37)32-21(23)22(28,29)30)6-34(18(10)31-19)16-12(25)2-9(24)3-13(16)26/h2-4,6,8,15,21,35H,5,7H2,1H3,(H,32,37)/t8-,15-,21+/m1/s1 |
| InChIKey | MQJSMHRATHYBCU-KVTSBQEPSA-N |
| XLogP | 3.62 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|