C22H17ClF6N4O4 — CID 134360192
1-(2-chloro-4,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,8-naphthyridine-3-carboxamide (PubChem CID 134360192) has the molecular formula C22H17ClF6N4O4 and a molecular weight of 550.84 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(2-chloro-4,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134360192 |
| Molecular Formula | C22H17ClF6N4O4 |
| Molecular Weight | 550.84 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | 1-(2-chloro-4,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,8-naphthyridine-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn(-c2c(F)cc(F)cc2Cl)c2nc(N3C[C@@H](O)[C@H](O)C3)c(F)cc2c1=O)C(F)(F)F |
| InChI | InChI=1S/C22H17ClF6N4O4/c1-8(22(27,28)29)30-21(37)11-5-33(17-12(23)2-9(24)3-13(17)25)19-10(18(11)36)4-14(26)20(31-19)32-6-15(34)16(35)7-32/h2-5,8,15-16,34-35H,6-7H2,1H3,(H,30,37)/t8-,15+,16+/m0/s1 |
| InChIKey | OJRKYMKLSGHEHI-OCJYXSBASA-N |
| XLogP | 2.68 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.84 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |