C24H21F7N4O5 — CID 134346783
7-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[1-(trifluoromethoxy)butan-2-yl]-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 134346783) has the molecular formula C24H21F7N4O5 and a molecular weight of 578.44 g/mol. Its IUPAC name is 7-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[1-(trifluoromethoxy)butan-2-yl]-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[1-(trifluoromethoxy)butan-2-yl]-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134346783 |
| Molecular Formula | C24H21F7N4O5 |
| Molecular Weight | 578.44 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | 7-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[1-(trifluoromethoxy)butan-2-yl]-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CCC(COC(F)(F)F)NC(=O)c1cn(-c2c(F)cc(F)cc2F)c2nc(N3C[C@@H](O)[C@@H](O)C3)c(F)cc2c1=O |
| InChI | InChI=1S/C24H21F7N4O5/c1-2-11(9-40-24(29,30)31)32-23(39)13-6-35(19-14(26)3-10(25)4-15(19)27)21-12(20(13)38)5-16(28)22(33-21)34-7-17(36)18(37)8-34/h3-6,11,17-18,36-37H,2,7-9H2,1H3,(H,32,39)/t11?,17-,18+ |
| InChIKey | RUYNWJJANNUICG-DSCFNSEDSA-N |
| XLogP | 2.53 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |