C23H17F7N4O3 — CID 139431801
N-(1-cyclopropyl-2,2,2-trifluoroethyl)-6-fluoro-7-(3-hydroxyazetidin-1-yl)-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 139431801) has the molecular formula C23H17F7N4O3 and a molecular weight of 530.40 g/mol. Its IUPAC name is N-(1-cyclopropyl-2,2,2-trifluoroethyl)-6-fluoro-7-(3-hydroxyazetidin-1-yl)-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(1-cyclopropyl-2,2,2-trifluoroethyl)-6-fluoro-7-(3-hydroxyazetidin-1-yl)-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 139431801 |
| Molecular Formula | C23H17F7N4O3 |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | N-(1-cyclopropyl-2,2,2-trifluoroethyl)-6-fluoro-7-(3-hydroxyazetidin-1-yl)-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NC(C1CC1)C(F)(F)F)c1cn(-c2c(F)cc(F)cc2F)c2nc(N3CC(O)C3)c(F)cc2c1=O |
| InChI | InChI=1S/C23H17F7N4O3/c24-10-3-14(25)17(15(26)4-10)34-8-13(22(37)31-19(9-1-2-9)23(28,29)30)18(36)12-5-16(27)21(32-20(12)34)33-6-11(35)7-33/h3-5,8-9,11,19,35H,1-2,6-7H2,(H,31,37) |
| InChIKey | GMYVLEHXKYSXRN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |