C23H17F6N5O3 — CID 135354869
N-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-oxo-7-(2-oxoimidazolidin-1-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 135354869) has the molecular formula C23H17F6N5O3 and a molecular weight of 525.41 g/mol. Its IUPAC name is N-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-oxo-7-(2-oxoimidazolidin-1-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-oxo-7-(2-oxoimidazolidin-1-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135354869 |
| Molecular Formula | C23H17F6N5O3 |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | N-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-oxo-7-(2-oxoimidazolidin-1-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NC(C1CC1)C(F)(F)F)c1cn(-c2c(F)cc(F)cc2F)c2nc(N3CCNC3=O)ccc2c1=O |
| InChI | InChI=1S/C23H17F6N5O3/c24-11-7-14(25)17(15(26)8-11)34-9-13(21(36)32-19(10-1-2-10)23(27,28)29)18(35)12-3-4-16(31-20(12)34)33-6-5-30-22(33)37/h3-4,7-10,19H,1-2,5-6H2,(H,30,37)(H,32,36) |
| InChIKey | UNLRMSQVPPWFAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |