C23H18F6N4O4 — CID 135354967
2-[[6-[(1-cyclopropyl-2,2,2-trifluoroethyl)carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]-methylamino]acetic acid (PubChem CID 135354967) has the molecular formula C23H18F6N4O4 and a molecular weight of 528.41 g/mol. Its IUPAC name is 2-[[6-[(1-cyclopropyl-2,2,2-trifluoroethyl)carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]-methylamino]acetic acid.
| Compound Name | 2-[[6-[(1-cyclopropyl-2,2,2-trifluoroethyl)carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 135354967 |
| Molecular Formula | C23H18F6N4O4 |
| Molecular Weight | 528.41 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 2-[[6-[(1-cyclopropyl-2,2,2-trifluoroethyl)carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)c1ccc2c(=O)c(C(=O)NC(C3CC3)C(F)(F)F)cn(-c3c(F)cc(F)cc3F)c2n1 |
| InChI | InChI=1S/C23H18F6N4O4/c1-32(9-17(34)35)16-5-4-12-19(36)13(22(37)31-20(10-2-3-10)23(27,28)29)8-33(21(12)30-16)18-14(25)6-11(24)7-15(18)26/h4-8,10,20H,2-3,9H2,1H3,(H,31,37)(H,34,35) |
| InChIKey | FEEPJBOBKFBCCD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |