C29H30F6N4O4 — CID 147989210
tert-butyl (3S)-4-[[6-[[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]amino]-3-methylbutanoate (PubChem CID 147989210) has the molecular formula C29H30F6N4O4 and a molecular weight of 612.57 g/mol. Its IUPAC name is tert-butyl (3S)-4-[[6-[[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]amino]-3-methylbutanoate.
| Compound Name | tert-butyl (3S)-4-[[6-[[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 147989210 |
| Molecular Formula | C29H30F6N4O4 |
| Molecular Weight | 612.57 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | tert-butyl (3S)-4-[[6-[[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]amino]-3-methylbutanoate |
| SMILES | C[C@H](CNc1ccc2c(=O)c(C(=O)N[C@@H](C3CC3)C(F)(F)F)cn(-c3c(F)cc(F)cc3F)c2n1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H30F6N4O4/c1-14(9-22(40)43-28(2,3)4)12-36-21-8-7-17-24(41)18(27(42)38-25(15-5-6-15)29(33,34)35)13-39(26(17)37-21)23-19(31)10-16(30)11-20(23)32/h7-8,10-11,13-15,25H,5-6,9,12H2,1-4H3,(H,36,37)(H,38,42)/t14-,25-/m0/s1 |
| InChIKey | IUSNMLWQDIWCTA-SXBQZSJRSA-N |
| XLogP | 5.65 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |