C28H29F6N5O4 — CID 155051245
tert-butyl N-[1-[[6-[(1-cyclopropyl-2,2,2-trifluoroethyl)carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]amino]propan-2-yl]carbamate (PubChem CID 155051245) has the molecular formula C28H29F6N5O4 and a molecular weight of 613.56 g/mol. Its IUPAC name is tert-butyl N-[1-[[6-[(1-cyclopropyl-2,2,2-trifluoroethyl)carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[6-[(1-cyclopropyl-2,2,2-trifluoroethyl)carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 155051245 |
| Molecular Formula | C28H29F6N5O4 |
| Molecular Weight | 613.56 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | tert-butyl N-[1-[[6-[(1-cyclopropyl-2,2,2-trifluoroethyl)carbamoyl]-5-oxo-8-(2,4,6-trifluorophenyl)-1,8-naphthyridin-2-yl]amino]propan-2-yl]carbamate |
| SMILES | CC(CNc1ccc2c(=O)c(C(=O)NC(C3CC3)C(F)(F)F)cn(-c3c(F)cc(F)cc3F)c2n1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H29F6N5O4/c1-13(36-26(42)43-27(2,3)4)11-35-20-8-7-16-22(40)17(25(41)38-23(14-5-6-14)28(32,33)34)12-39(24(16)37-20)21-18(30)9-15(29)10-19(21)31/h7-10,12-14,23H,5-6,11H2,1-4H3,(H,35,37)(H,36,42)(H,38,41) |
| InChIKey | RYLUVKCMTLQYEC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |