C26H25F5N4O4 — CID 134360113
N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-1-(4-fluoro-2,6-dimethylphenyl)-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 134360113) has the molecular formula C26H25F5N4O4 and a molecular weight of 552.50 g/mol. Its IUPAC name is N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-1-(4-fluoro-2,6-dimethylphenyl)-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-1-(4-fluoro-2,6-dimethylphenyl)-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134360113 |
| Molecular Formula | C26H25F5N4O4 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | N-[(1S)-1-cyclopropyl-2,2,2-trifluoroethyl]-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-1-(4-fluoro-2,6-dimethylphenyl)-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1cc(F)cc(C)c1-n1cc(C(=O)N[C@@H](C2CC2)C(F)(F)F)c(=O)c2cc(F)c(N3C[C@@H](O)[C@H](O)C3)nc21 |
| InChI | InChI=1S/C26H25F5N4O4/c1-11-5-14(27)6-12(2)20(11)35-8-16(25(39)32-22(13-3-4-13)26(29,30)31)21(38)15-7-17(28)24(33-23(15)35)34-9-18(36)19(37)10-34/h5-8,13,18-19,22,36-37H,3-4,9-10H2,1-2H3,(H,32,39)/t18-,19-,22+/m1/s1 |
| InChIKey | GSQKECSUKYBSQC-KNKQGSTJSA-N |
| XLogP | 2.89 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |