C26H28F4N4O4 — CID 134360176
7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1-(2,4,6-trifluorophenyl)-N-(2,3,3-trimethylbutan-2-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 134360176) has the molecular formula C26H28F4N4O4 and a molecular weight of 536.53 g/mol. Its IUPAC name is 7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1-(2,4,6-trifluorophenyl)-N-(2,3,3-trimethylbutan-2-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1-(2,4,6-trifluorophenyl)-N-(2,3,3-trimethylbutan-2-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134360176 |
| Molecular Formula | C26H28F4N4O4 |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1-(2,4,6-trifluorophenyl)-N-(2,3,3-trimethylbutan-2-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CC(C)(C)C(C)(C)NC(=O)c1cn(-c2c(F)cc(F)cc2F)c2nc(N3C[C@@H](O)[C@H](O)C3)c(F)cc2c1=O |
| InChI | InChI=1S/C26H28F4N4O4/c1-25(2,3)26(4,5)32-24(38)14-9-34(20-15(28)6-12(27)7-16(20)29)22-13(21(14)37)8-17(30)23(31-22)33-10-18(35)19(36)11-33/h6-9,18-19,35-36H,10-11H2,1-5H3,(H,32,38)/t18-,19-/m1/s1 |
| InChIKey | QLTAESPDNJENFW-RTBURBONSA-N |
| XLogP | 3.04 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |