C27H22F4N4O4 — CID 134360118
7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[(1S)-1-phenylethyl]-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 134360118) has the molecular formula C27H22F4N4O4 and a molecular weight of 542.49 g/mol. Its IUPAC name is 7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[(1S)-1-phenylethyl]-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[(1S)-1-phenylethyl]-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134360118 |
| Molecular Formula | C27H22F4N4O4 |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-N-[(1S)-1-phenylethyl]-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn(-c2c(F)cc(F)cc2F)c2nc(N3C[C@@H](O)[C@H](O)C3)c(F)cc2c1=O)c1ccccc1 |
| InChI | InChI=1S/C27H22F4N4O4/c1-13(14-5-3-2-4-6-14)32-27(39)17-10-35(23-18(29)7-15(28)8-19(23)30)25-16(24(17)38)9-20(31)26(33-25)34-11-21(36)22(37)12-34/h2-10,13,21-22,36-37H,11-12H2,1H3,(H,32,39)/t13-,21+,22+/m0/s1 |
| InChIKey | HTFJVHDDKRFOTK-KGRLDLLASA-N |
| XLogP | 2.97 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |