C24H20F6N4O4 — CID 139431725
N-(1-cyclopropyl-2,2,2-trifluoroethyl)-1-(2,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 139431725) has the molecular formula C24H20F6N4O4 and a molecular weight of 542.44 g/mol. Its IUPAC name is N-(1-cyclopropyl-2,2,2-trifluoroethyl)-1-(2,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(1-cyclopropyl-2,2,2-trifluoroethyl)-1-(2,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 139431725 |
| Molecular Formula | C24H20F6N4O4 |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | N-(1-cyclopropyl-2,2,2-trifluoroethyl)-1-(2,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NC(C1CC1)C(F)(F)F)c1cn(-c2c(F)cccc2F)c2nc(N3C[C@@H](O)[C@H](O)C3)c(F)cc2c1=O |
| InChI | InChI=1S/C24H20F6N4O4/c25-13-2-1-3-14(26)18(13)34-7-12(23(38)31-20(10-4-5-10)24(28,29)30)19(37)11-6-15(27)22(32-21(11)34)33-8-16(35)17(36)9-33/h1-3,6-7,10,16-17,20,35-36H,4-5,8-9H2,(H,31,38)/t16-,17-,20?/m1/s1 |
| InChIKey | WXSHFGCREFIMBN-LGJCEAAXSA-N |
| XLogP | 2.42 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |