C25H23F5N4O4 — CID 153426324
N-[(1S)-1-cyclopropyl-2,2-difluoropropyl]-1-(2,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 153426324) has the molecular formula C25H23F5N4O4 and a molecular weight of 538.47 g/mol. Its IUPAC name is N-[(1S)-1-cyclopropyl-2,2-difluoropropyl]-1-(2,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-[(1S)-1-cyclopropyl-2,2-difluoropropyl]-1-(2,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 153426324 |
| Molecular Formula | C25H23F5N4O4 |
| Molecular Weight | 538.47 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | N-[(1S)-1-cyclopropyl-2,2-difluoropropyl]-1-(2,6-difluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CC(F)(F)[C@@H](NC(=O)c1cn(-c2c(F)cccc2F)c2nc(N3C[C@@H](O)[C@H](O)C3)c(F)cc2c1=O)C1CC1 |
| InChI | InChI=1S/C25H23F5N4O4/c1-25(29,30)21(11-5-6-11)31-24(38)13-8-34(19-14(26)3-2-4-15(19)27)22-12(20(13)37)7-16(28)23(32-22)33-9-17(35)18(36)10-33/h2-4,7-8,11,17-18,21,35-36H,5-6,9-10H2,1H3,(H,31,38)/t17-,18-,21+/m1/s1 |
| InChIKey | HYTNYGMLEUFDLV-OPYAIIAOSA-N |
| XLogP | 2.51 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |