C20H13ClF5N3O2 — CID 135354811
7-chloro-N-[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]-1-(2,6-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 135354811) has the molecular formula C20H13ClF5N3O2 and a molecular weight of 457.79 g/mol. Its IUPAC name is 7-chloro-N-[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]-1-(2,6-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-chloro-N-[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]-1-(2,6-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135354811 |
| Molecular Formula | C20H13ClF5N3O2 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 7-chloro-N-[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]-1-(2,6-difluorophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(N[C@H](C1CC1)C(F)(F)F)c1cn(-c2c(F)cccc2F)c2nc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H13ClF5N3O2/c21-14-7-6-10-16(30)11(19(31)28-17(9-4-5-9)20(24,25)26)8-29(18(10)27-14)15-12(22)2-1-3-13(15)23/h1-3,6-9,17H,4-5H2,(H,28,31)/t17-/m1/s1 |
| InChIKey | LRAGZARGKKAZMZ-QGZVFWFLSA-N |
| XLogP | 4.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|