C19H13Cl2F4N3O2 — CID 135354802
7-chloro-1-(2-chloro-6-fluorophenyl)-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 135354802) has the molecular formula C19H13Cl2F4N3O2 and a molecular weight of 462.23 g/mol. Its IUPAC name is 7-chloro-1-(2-chloro-6-fluorophenyl)-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-chloro-1-(2-chloro-6-fluorophenyl)-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135354802 |
| Molecular Formula | C19H13Cl2F4N3O2 |
| Molecular Weight | 462.23 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 7-chloro-1-(2-chloro-6-fluorophenyl)-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1cn(-c2c(F)cccc2Cl)c2nc(Cl)ccc2c1=O)C(F)(F)F |
| InChI | InChI=1S/C19H13Cl2F4N3O2/c1-2-13(19(23,24)25)26-18(30)10-8-28(15-11(20)4-3-5-12(15)22)17-9(16(10)29)6-7-14(21)27-17/h3-8,13H,2H2,1H3,(H,26,30) |
| InChIKey | UFFSZEWKFVUSMO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.23 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|