C23H21ClF4N4O4 — CID 135354949
1-(2-chloro-6-fluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 135354949) has the molecular formula C23H21ClF4N4O4 and a molecular weight of 528.89 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135354949 |
| Molecular Formula | C23H21ClF4N4O4 |
| Molecular Weight | 528.89 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-7-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-4-oxo-N-(1,1,1-trifluorobutan-2-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1cn(-c2c(F)cccc2Cl)c2nc(N3C[C@@H](O)[C@H](O)C3)ccc2c1=O)C(F)(F)F |
| InChI | InChI=1S/C23H21ClF4N4O4/c1-2-17(23(26,27)28)29-22(36)12-8-32(19-13(24)4-3-5-14(19)25)21-11(20(12)35)6-7-18(30-21)31-9-15(33)16(34)10-31/h3-8,15-17,33-34H,2,9-10H2,1H3,(H,29,36)/t15-,16-,17?/m1/s1 |
| InChIKey | SSRNZNNTTNDKMY-YNPPLXCJSA-N |
| XLogP | 2.79 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.89 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |