C23H20F6N4O3 — CID 135354923
N-(1-cyclopropyl-2,2,2-trifluoroethyl)-7-[2-hydroxyethyl(methyl)amino]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 135354923) has the molecular formula C23H20F6N4O3 and a molecular weight of 514.43 g/mol. Its IUPAC name is N-(1-cyclopropyl-2,2,2-trifluoroethyl)-7-[2-hydroxyethyl(methyl)amino]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(1-cyclopropyl-2,2,2-trifluoroethyl)-7-[2-hydroxyethyl(methyl)amino]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135354923 |
| Molecular Formula | C23H20F6N4O3 |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | N-(1-cyclopropyl-2,2,2-trifluoroethyl)-7-[2-hydroxyethyl(methyl)amino]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CN(CCO)c1ccc2c(=O)c(C(=O)NC(C3CC3)C(F)(F)F)cn(-c3c(F)cc(F)cc3F)c2n1 |
| InChI | InChI=1S/C23H20F6N4O3/c1-32(6-7-34)17-5-4-13-19(35)14(22(36)31-20(11-2-3-11)23(27,28)29)10-33(21(13)30-17)18-15(25)8-12(24)9-16(18)26/h4-5,8-11,20,34H,2-3,6-7H2,1H3,(H,31,36) |
| InChIKey | XWPPBODLEKAZKA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |