C22H22Cl2FN3O3 — CID 19374411
5,8-dichloro-1-cyclopropyl-6-fluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 19374411) has the molecular formula C22H22Cl2FN3O3 and a molecular weight of 466.34 g/mol. Its IUPAC name is 5,8-dichloro-1-cyclopropyl-6-fluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5,8-dichloro-1-cyclopropyl-6-fluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19374411 |
| Molecular Formula | C22H22Cl2FN3O3 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 5,8-dichloro-1-cyclopropyl-6-fluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CNC1C=CCC2CN(c3c(F)c(Cl)c4c(=O)c(C(=O)O)cn(C5CC5)c4c3Cl)CC21 |
| InChI | InChI=1S/C22H22Cl2FN3O3/c1-26-14-4-2-3-10-7-27(8-12(10)14)20-17(24)19-15(16(23)18(20)25)21(29)13(22(30)31)9-28(19)11-5-6-11/h2,4,9-12,14,26H,3,5-8H2,1H3,(H,30,31) |
| InChIKey | DUCXGUBCZKHUFX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|