C22H24F2N4O3 — CID 54259058
5-amino-1-cyclopropyl-6,8-difluoro-7-[4-(methylamino)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 54259058) has the molecular formula C22H24F2N4O3 and a molecular weight of 430.46 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-6,8-difluoro-7-[4-(methylamino)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-1-cyclopropyl-6,8-difluoro-7-[4-(methylamino)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54259058 |
| Molecular Formula | C22H24F2N4O3 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 5-amino-1-cyclopropyl-6,8-difluoro-7-[4-(methylamino)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CNC1CC=CC2CN(c3c(F)c(N)c4c(=O)c(C(=O)O)cn(C5CC5)c4c3F)CC21 |
| InChI | InChI=1S/C22H24F2N4O3/c1-26-14-4-2-3-10-7-27(8-12(10)14)20-16(23)18(25)15-19(17(20)24)28(11-5-6-11)9-13(21(15)29)22(30)31/h2-3,9-12,14,26H,4-8,25H2,1H3,(H,30,31) |
| InChIKey | RCEHAURSDGYHGK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|