C22H23ClFN3O2S — CID 54149193
8-chloro-1-cyclopropyl-6-fluoro-7-[4-(methylamino)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-4-sulfanylidenequinoline-3-carboxylic acid (PubChem CID 54149193) has the molecular formula C22H23ClFN3O2S and a molecular weight of 447.96 g/mol. Its IUPAC name is 8-chloro-1-cyclopropyl-6-fluoro-7-[4-(methylamino)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-4-sulfanylidenequinoline-3-carboxylic acid.
| Compound Name | 8-chloro-1-cyclopropyl-6-fluoro-7-[4-(methylamino)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-4-sulfanylidenequinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54149193 |
| Molecular Formula | C22H23ClFN3O2S |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 8-chloro-1-cyclopropyl-6-fluoro-7-[4-(methylamino)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-4-sulfanylidenequinoline-3-carboxylic acid |
| SMILES | CNC1CC=CC2CN(c3c(F)cc4c(=S)c(C(=O)O)cn(C5CC5)c4c3Cl)CC21 |
| InChI | InChI=1S/C22H23ClFN3O2S/c1-25-17-4-2-3-11-8-26(9-14(11)17)20-16(24)7-13-19(18(20)23)27(12-5-6-12)10-15(21(13)30)22(28)29/h2-3,7,10-12,14,17,25H,4-6,8-9H2,1H3,(H,28,29) |
| InChIKey | OGNZKKOSFDHPGY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|