C24H25ClFN3O3 — CID 19374416
7-(4-amino-7-cyclopropyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 19374416) has the molecular formula C24H25ClFN3O3 and a molecular weight of 457.93 g/mol. Its IUPAC name is 7-(4-amino-7-cyclopropyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(4-amino-7-cyclopropyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19374416 |
| Molecular Formula | C24H25ClFN3O3 |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 7-(4-amino-7-cyclopropyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | NC1C=CC(C2CC2)C2CN(c3c(F)cc4c(=O)c(C(=O)O)cn(C5CC5)c4c3Cl)CC12 |
| InChI | InChI=1S/C24H25ClFN3O3/c25-20-21-14(23(30)17(24(31)32)10-29(21)12-3-4-12)7-18(26)22(20)28-8-15-13(11-1-2-11)5-6-19(27)16(15)9-28/h5-7,10-13,15-16,19H,1-4,8-9,27H2,(H,31,32) |
| InChIKey | XTEPZXWNETTYDD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|