C22H23F2N3O3 — CID 54447255
7-[(4R)-4-(aminomethyl)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 54447255) has the molecular formula C22H23F2N3O3 and a molecular weight of 415.44 g/mol. Its IUPAC name is 7-[(4R)-4-(aminomethyl)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(4R)-4-(aminomethyl)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54447255 |
| Molecular Formula | C22H23F2N3O3 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 7-[(4R)-4-(aminomethyl)-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | NC[C@@H]1CC=CC2CN(c3c(F)cc4c(=O)c(C(=O)O)cn(C5CC5)c4c3F)CC21 |
| InChI | InChI=1S/C22H23F2N3O3/c23-17-6-14-19(27(13-4-5-13)10-16(21(14)28)22(29)30)18(24)20(17)26-8-12-3-1-2-11(7-25)15(12)9-26/h1,3,6,10-13,15H,2,4-5,7-9,25H2,(H,29,30)/t11-,12?,15?/m0/s1 |
| InChIKey | WSJWZKMJHGTWEJ-BZUNDVKYSA-N |
| XLogP | 2.90 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|