C18H14F2N4O5 — CID 23284812
1-(5-amino-2,4-difluorophenyl)-8-methyl-7-(methylamino)-6-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 23284812) has the molecular formula C18H14F2N4O5 and a molecular weight of 404.33 g/mol. Its IUPAC name is 1-(5-amino-2,4-difluorophenyl)-8-methyl-7-(methylamino)-6-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(5-amino-2,4-difluorophenyl)-8-methyl-7-(methylamino)-6-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23284812 |
| Molecular Formula | C18H14F2N4O5 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-(5-amino-2,4-difluorophenyl)-8-methyl-7-(methylamino)-6-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CNc1c([N+](=O)[O-])cc2c(=O)c(C(=O)O)cn(-c3cc(N)c(F)cc3F)c2c1C |
| InChI | InChI=1S/C18H14F2N4O5/c1-7-15(22-2)14(24(28)29)3-8-16(7)23(6-9(17(8)25)18(26)27)13-5-12(21)10(19)4-11(13)20/h3-6,22H,21H2,1-2H3,(H,26,27) |
| InChIKey | PRPYZPJSUMUXDI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|