About 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid
1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid (PubChem CID 23284814) has the molecular formula C19H12F3N3O3
and a molecular weight of 387.32 g/mol. Its IUPAC name is 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid |
| PubChem CID | 23284814 |
| Molecular Formula | C19H12F3N3O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid |
| SMILES | C#Cc1c(NC)c(F)cc2c(=O)c(C(=O)O)cn(-c3cc(N)c(F)cc3F)c12 |
| InChI | InChI=1S/C19H12F3N3O3/c1-3-8-16(24-2)13(22)4-9-17(8)25(7-10(18(9)26)19(27)28)15-6-14(23)11(20)5-12(15)21/h1,4-7,24H,23H2,2H3,(H,27,28) |
| InChIKey | RRTVKKWXRINTOI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid?
The IUPAC name of 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid (CID 23284814) is 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid.
What is the SMILES notation for 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid?
The canonical SMILES for 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid is C#Cc1c(NC)c(F)cc2c(=O)c(C(=O)O)cn(-c3cc(N)c(F)cc3F)c12.
What is the InChIKey of 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid?
The InChIKey is RRTVKKWXRINTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3N3O3/c1-3-8-16(24-2)13(22)4-9-17(8)25(7-10(18(9)26)19(27)28)15-6-14(23)11(20)5-12(15)21/h1,4-7,24H,23H2,2H3,(H,27,28).
What are the key properties of 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid?
1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid has a molecular weight of 387.32 g/mol, XLogP of 2.71, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-2,4-difluorophenyl)-8-ethynyl-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid is sourced from PubChem (CID 23284814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).