C15H12F2N2O5 — CID 139840412
ethyl 1-cyclopropyl-7,8-difluoro-6-nitro-4-oxoquinoline-3-carboxylate (PubChem CID 139840412) has the molecular formula C15H12F2N2O5 and a molecular weight of 338.27 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-7,8-difluoro-6-nitro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-7,8-difluoro-6-nitro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 139840412 |
| Molecular Formula | C15H12F2N2O5 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | ethyl 1-cyclopropyl-7,8-difluoro-6-nitro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(F)c(F)c([N+](=O)[O-])cc2c1=O |
| InChI | InChI=1S/C15H12F2N2O5/c1-2-24-15(21)9-6-18(7-3-4-7)13-8(14(9)20)5-10(19(22)23)11(16)12(13)17/h5-7H,2-4H2,1H3 |
| InChIKey | IPEJBTQRAZJEMV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|