About CID 66985803
CID 66985803 (PubChem CID 66985803) has the molecular formula C30H38ClFN2O5Si
and a molecular weight of 589.18 g/mol.
Molecular Properties
| Compound Name | CID 66985803 |
| PubChem CID | 66985803 |
| Molecular Formula | C30H38ClFN2O5Si |
| Molecular Weight | 589.18 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1cn([C@@H](C(C)C)C(C)(C)O[Si]C(C)(C)C)c2cc(Cc3cccc(Cl)c3F)c(OC)nc2c1=O |
| InChI | InChI=1S/C30H38ClFN2O5Si/c1-10-38-28(36)20-16-34(26(17(2)3)30(7,8)39-40-29(4,5)6)22-15-19(27(37-9)33-24(22)25(20)35)14-18-12-11-13-21(31)23(18)32/h11-13,15-17,26H,10,14H2,1-9H3/t26-/m0/s1 |
| InChIKey | RGJNPEJEOOQFFN-SANMLTNESA-N |
| XLogP | 6.80 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 589.18 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66985803 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66985803?
The IUPAC name of CID 66985803 (CID 66985803) is not available.
What is the SMILES notation for CID 66985803?
The canonical SMILES for CID 66985803 is CCOC(=O)c1cn([C@@H](C(C)C)C(C)(C)O[Si]C(C)(C)C)c2cc(Cc3cccc(Cl)c3F)c(OC)nc2c1=O.
What is the InChIKey of CID 66985803?
The InChIKey is RGJNPEJEOOQFFN-SANMLTNESA-N. The full InChI is InChI=1S/C30H38ClFN2O5Si/c1-10-38-28(36)20-16-34(26(17(2)3)30(7,8)39-40-29(4,5)6)22-15-19(27(37-9)33-24(22)25(20)35)14-18-12-11-13-21(31)23(18)32/h11-13,15-17,26H,10,14H2,1-9H3/t26-/m0/s1.
What are the key properties of CID 66985803?
CID 66985803 has a molecular weight of 589.18 g/mol, XLogP of 6.80, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66985803 is sourced from PubChem (CID 66985803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).