C30H39ClFN2O5Si — CID 66985799
CID 66985799 (PubChem CID 66985799) has the molecular formula C30H39ClFN2O5Si and a molecular weight of 590.19 g/mol.
| Compound Name | CID 66985799 |
|---|---|
| PubChem CID | 66985799 |
| Molecular Formula | C30H39ClFN2O5Si |
| Molecular Weight | 590.19 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1cn([C@@H](C(C)C)C(O[Si](C)C)C(C)(C)C)c2cc(Cc3cccc(Cl)c3F)c(OC)nc2c1=O |
| InChI | InChI=1S/C30H39ClFN2O5Si/c1-10-38-29(36)20-16-34(25(17(2)3)27(30(4,5)6)39-40(8)9)22-15-19(28(37-7)33-24(22)26(20)35)14-18-12-11-13-21(31)23(18)32/h11-13,15-17,25,27H,10,14H2,1-9H3/t25-,27?/m0/s1 |
| InChIKey | IBIYNAOJJINXQO-PVCWFJFTSA-N |
| XLogP | 6.84 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.19 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|