C13H11F2NO4 — CID 144602812
fluoro 7-fluoro-1-(2-hydroxyethyl)-6-methyl-4-oxoquinoline-3-carboxylate (PubChem CID 144602812) has the molecular formula C13H11F2NO4 and a molecular weight of 283.23 g/mol. Its IUPAC name is fluoro 7-fluoro-1-(2-hydroxyethyl)-6-methyl-4-oxoquinoline-3-carboxylate.
| Compound Name | fluoro 7-fluoro-1-(2-hydroxyethyl)-6-methyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 144602812 |
| Molecular Formula | C13H11F2NO4 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | fluoro 7-fluoro-1-(2-hydroxyethyl)-6-methyl-4-oxoquinoline-3-carboxylate |
| SMILES | Cc1cc2c(=O)c(C(=O)OF)cn(CCO)c2cc1F |
| InChI | InChI=1S/C13H11F2NO4/c1-7-4-8-11(5-10(7)14)16(2-3-17)6-9(12(8)18)13(19)20-15/h4-6,17H,2-3H2,1H3 |
| InChIKey | MBRDEGLHLCKHGU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |