About [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate
[6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 87957353) has the molecular formula C12H8F3NO4
and a molecular weight of 287.19 g/mol. Its IUPAC name is [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate.
Analyze [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate?
The IUPAC name of [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate (CID 87957353) is [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate.
What is the SMILES notation for [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate?
The canonical SMILES for [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate is O=C(O)Oc1cn(CCF)c2cc(F)c(F)cc2c1=O.
What is the InChIKey of [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate?
The InChIKey is AOYMBIYLSIOXPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO4/c13-1-2-16-5-10(20-12(18)19)11(17)6-3-7(14)8(15)4-9(6)16/h3-5H,1-2H2,(H,18,19).
What are the key properties of [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate?
[6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate has a molecular weight of 287.19 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinolin-3-yl] hydrogen carbonate is sourced from PubChem (CID 87957353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).