C17H19F2NO6 — CID 139765993
6,7-difluoro-1-[2-[2-(1-methoxyethoxy)ethoxy]ethyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 139765993) has the molecular formula C17H19F2NO6 and a molecular weight of 371.34 g/mol. Its IUPAC name is 6,7-difluoro-1-[2-[2-(1-methoxyethoxy)ethoxy]ethyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6,7-difluoro-1-[2-[2-(1-methoxyethoxy)ethoxy]ethyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139765993 |
| Molecular Formula | C17H19F2NO6 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 6,7-difluoro-1-[2-[2-(1-methoxyethoxy)ethoxy]ethyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | COC(C)OCCOCCn1cc(C(=O)O)c(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C17H19F2NO6/c1-10(24-2)26-6-5-25-4-3-20-9-12(17(22)23)16(21)11-7-13(18)14(19)8-15(11)20/h7-10H,3-6H2,1-2H3,(H,22,23) |
| InChIKey | KJICOBHMDUYYDE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|