C15H15ClFNO3 — CID 70388176
7-chloro-6-fluoro-4-oxo-1-pentylquinoline-3-carboxylic acid (PubChem CID 70388176) has the molecular formula C15H15ClFNO3 and a molecular weight of 311.74 g/mol. Its IUPAC name is 7-chloro-6-fluoro-4-oxo-1-pentylquinoline-3-carboxylic acid.
| Compound Name | 7-chloro-6-fluoro-4-oxo-1-pentylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 70388176 |
| Molecular Formula | C15H15ClFNO3 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 7-chloro-6-fluoro-4-oxo-1-pentylquinoline-3-carboxylic acid |
| SMILES | CCCCCn1cc(C(=O)O)c(=O)c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C15H15ClFNO3/c1-2-3-4-5-18-8-10(15(20)21)14(19)9-6-12(17)11(16)7-13(9)18/h6-8H,2-5H2,1H3,(H,20,21) |
| InChIKey | WCVZLHADAWVVTO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|